C18H20Cl2N2O3S2 — CID 3270741
N-(2,6-dichloro-4-nitrophenyl)spiro[1,3-dithiolane-2,9'-bicyclo[3.3.1]nonane]-3'-carboxamide (PubChem CID 3270741) has the molecular formula C18H20Cl2N2O3S2 and a molecular weight of 447.41 g/mol. Its IUPAC name is N-(2,6-dichloro-4-nitrophenyl)spiro[1,3-dithiolane-2,9'-bicyclo[3.3.1]nonane]-3'-carboxamide.
| Compound Name | N-(2,6-dichloro-4-nitrophenyl)spiro[1,3-dithiolane-2,9'-bicyclo[3.3.1]nonane]-3'-carboxamide |
|---|---|
| PubChem CID | 3270741 |
| Molecular Formula | C18H20Cl2N2O3S2 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | N-(2,6-dichloro-4-nitrophenyl)spiro[1,3-dithiolane-2,9'-bicyclo[3.3.1]nonane]-3'-carboxamide |
| SMILES | O=C(Nc1c(Cl)cc([N+](=O)[O-])cc1Cl)C1CC2CCCC(C1)C21SCCS1 |
| InChI | InChI=1S/C18H20Cl2N2O3S2/c19-14-8-13(22(24)25)9-15(20)16(14)21-17(23)10-6-11-2-1-3-12(7-10)18(11)26-4-5-27-18/h8-12H,1-7H2,(H,21,23) |
| InChIKey | KHUUEQQITNVSGZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|