C16H19Cl2N3O3 — CID 133492676
cyclopentyl-[3-(2,6-dichloro-4-nitroanilino)pyrrolidin-1-yl]methanone (PubChem CID 133492676) has the molecular formula C16H19Cl2N3O3 and a molecular weight of 372.25 g/mol. Its IUPAC name is cyclopentyl-[3-(2,6-dichloro-4-nitroanilino)pyrrolidin-1-yl]methanone.
| Compound Name | cyclopentyl-[3-(2,6-dichloro-4-nitroanilino)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 133492676 |
| Molecular Formula | C16H19Cl2N3O3 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | cyclopentyl-[3-(2,6-dichloro-4-nitroanilino)pyrrolidin-1-yl]methanone |
| SMILES | O=C(C1CCCC1)N1CCC(Nc2c(Cl)cc([N+](=O)[O-])cc2Cl)C1 |
| InChI | InChI=1S/C16H19Cl2N3O3/c17-13-7-12(21(23)24)8-14(18)15(13)19-11-5-6-20(9-11)16(22)10-3-1-2-4-10/h7-8,10-11,19H,1-6,9H2 |
| InChIKey | XAHIFCCNPGRPAB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|