C16H19ClN4O — CID 133366780
3-chloro-6-[[1-(cyclopentanecarbonyl)pyrrolidin-3-yl]amino]pyridine-2-carbonitrile (PubChem CID 133366780) has the molecular formula C16H19ClN4O and a molecular weight of 318.81 g/mol. Its IUPAC name is 3-chloro-6-[[1-(cyclopentanecarbonyl)pyrrolidin-3-yl]amino]pyridine-2-carbonitrile.
| Compound Name | 3-chloro-6-[[1-(cyclopentanecarbonyl)pyrrolidin-3-yl]amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133366780 |
| Molecular Formula | C16H19ClN4O |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 3-chloro-6-[[1-(cyclopentanecarbonyl)pyrrolidin-3-yl]amino]pyridine-2-carbonitrile |
| SMILES | N#Cc1nc(NC2CCN(C(=O)C3CCCC3)C2)ccc1Cl |
| InChI | InChI=1S/C16H19ClN4O/c17-13-5-6-15(20-14(13)9-18)19-12-7-8-21(10-12)16(22)11-3-1-2-4-11/h5-6,11-12H,1-4,7-8,10H2,(H,19,20) |
| InChIKey | OJQLLLTUYCYKNR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |