C19H21BrFN3O — CID 133366907
[3-[(6-bromo-7-fluoroquinolin-2-yl)amino]pyrrolidin-1-yl]-cyclopentylmethanone (PubChem CID 133366907) has the molecular formula C19H21BrFN3O and a molecular weight of 406.30 g/mol. Its IUPAC name is [3-[(6-bromo-7-fluoroquinolin-2-yl)amino]pyrrolidin-1-yl]-cyclopentylmethanone.
| Compound Name | [3-[(6-bromo-7-fluoroquinolin-2-yl)amino]pyrrolidin-1-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 133366907 |
| Molecular Formula | C19H21BrFN3O |
| Molecular Weight | 406.30 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | [3-[(6-bromo-7-fluoroquinolin-2-yl)amino]pyrrolidin-1-yl]-cyclopentylmethanone |
| SMILES | O=C(C1CCCC1)N1CCC(Nc2ccc3cc(Br)c(F)cc3n2)C1 |
| InChI | InChI=1S/C19H21BrFN3O/c20-15-9-13-5-6-18(23-17(13)10-16(15)21)22-14-7-8-24(11-14)19(25)12-3-1-2-4-12/h5-6,9-10,12,14H,1-4,7-8,11H2,(H,22,23) |
| InChIKey | HDYVZUULKNYSSD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |