C14H19NO3S — CID 51463150
(3S)-1,1-dioxo-N-(4-propan-2-ylphenyl)thiolane-3-carboxamide (PubChem CID 51463150) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is (3S)-1,1-dioxo-N-(4-propan-2-ylphenyl)thiolane-3-carboxamide.
| Compound Name | (3S)-1,1-dioxo-N-(4-propan-2-ylphenyl)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 51463150 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (3S)-1,1-dioxo-N-(4-propan-2-ylphenyl)thiolane-3-carboxamide |
| SMILES | CC(C)c1ccc(NC(=O)[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C14H19NO3S/c1-10(2)11-3-5-13(6-4-11)15-14(16)12-7-8-19(17,18)9-12/h3-6,10,12H,7-9H2,1-2H3,(H,15,16)/t12-/m1/s1 |
| InChIKey | LGEZEUBEXILVCU-GFCCVEGCSA-N |
| XLogP | 2.18 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |