C17H21N3O6S — CID 163341406
1,1-dioxo-N-[5-(4-propan-2-ylphenyl)-1,3,4-oxadiazol-2-yl]thiolane-3-carboxamide;formic acid (PubChem CID 163341406) has the molecular formula C17H21N3O6S and a molecular weight of 395.44 g/mol. Its IUPAC name is 1,1-dioxo-N-[5-(4-propan-2-ylphenyl)-1,3,4-oxadiazol-2-yl]thiolane-3-carboxamide;formic acid.
| Compound Name | 1,1-dioxo-N-[5-(4-propan-2-ylphenyl)-1,3,4-oxadiazol-2-yl]thiolane-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 163341406 |
| Molecular Formula | C17H21N3O6S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 1,1-dioxo-N-[5-(4-propan-2-ylphenyl)-1,3,4-oxadiazol-2-yl]thiolane-3-carboxamide;formic acid |
| SMILES | CC(C)c1ccc(-c2nnc(NC(=O)C3CCS(=O)(=O)C3)o2)cc1.O=CO |
| InChI | InChI=1S/C16H19N3O4S.CH2O2/c1-10(2)11-3-5-12(6-4-11)15-18-19-16(23-15)17-14(20)13-7-8-24(21,22)9-13;2-1-3/h3-6,10,13H,7-9H2,1-2H3,(H,17,19,20);1H,(H,2,3) |
| InChIKey | TXGZERLJBPECPL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 139.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|