C11H14N2O5S2 — CID 60674860
1,1-dioxo-N-(4-sulfamoylphenyl)thiolane-3-carboxamide (PubChem CID 60674860) has the molecular formula C11H14N2O5S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 1,1-dioxo-N-(4-sulfamoylphenyl)thiolane-3-carboxamide.
| Compound Name | 1,1-dioxo-N-(4-sulfamoylphenyl)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 60674860 |
| Molecular Formula | C11H14N2O5S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 1,1-dioxo-N-(4-sulfamoylphenyl)thiolane-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C11H14N2O5S2/c12-20(17,18)10-3-1-9(2-4-10)13-11(14)8-5-6-19(15,16)7-8/h1-4,8H,5-7H2,(H,13,14)(H2,12,17,18) |
| InChIKey | FKMDHPIHEPIQLN-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |