C11H19NO4S — CID 43392962
N-(4-hydroxycyclohexyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 43392962) has the molecular formula C11H19NO4S and a molecular weight of 261.34 g/mol. Its IUPAC name is N-(4-hydroxycyclohexyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(4-hydroxycyclohexyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 43392962 |
| Molecular Formula | C11H19NO4S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-(4-hydroxycyclohexyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(NC1CCC(O)CC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H19NO4S/c13-10-3-1-9(2-4-10)12-11(14)8-5-6-17(15,16)7-8/h8-10,13H,1-7H2,(H,12,14) |
| InChIKey | WSLSZFYPXBDNPF-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |