C15H22N2O5S2 — CID 8843843
(3S)-1,1-dioxo-N'-(2,3,5,6-tetramethylphenyl)sulfonylthiolane-3-carbohydrazide (PubChem CID 8843843) has the molecular formula C15H22N2O5S2 and a molecular weight of 374.48 g/mol. Its IUPAC name is (3S)-1,1-dioxo-N'-(2,3,5,6-tetramethylphenyl)sulfonylthiolane-3-carbohydrazide.
| Compound Name | (3S)-1,1-dioxo-N'-(2,3,5,6-tetramethylphenyl)sulfonylthiolane-3-carbohydrazide |
|---|---|
| PubChem CID | 8843843 |
| Molecular Formula | C15H22N2O5S2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (3S)-1,1-dioxo-N'-(2,3,5,6-tetramethylphenyl)sulfonylthiolane-3-carbohydrazide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)NNC(=O)[C@@H]2CCS(=O)(=O)C2)c1C |
| InChI | InChI=1S/C15H22N2O5S2/c1-9-7-10(2)12(4)14(11(9)3)24(21,22)17-16-15(18)13-5-6-23(19,20)8-13/h7,13,17H,5-6,8H2,1-4H3,(H,16,18)/t13-/m1/s1 |
| InChIKey | HLUPRILWIRTJRF-CYBMUJFWSA-N |
| XLogP | 0.66 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|