C13H18N2O5S2 — CID 8843879
(3S)-N'-(2,4-dimethylphenyl)sulfonyl-1,1-dioxothiolane-3-carbohydrazide (PubChem CID 8843879) has the molecular formula C13H18N2O5S2 and a molecular weight of 346.43 g/mol. Its IUPAC name is (3S)-N'-(2,4-dimethylphenyl)sulfonyl-1,1-dioxothiolane-3-carbohydrazide.
| Compound Name | (3S)-N'-(2,4-dimethylphenyl)sulfonyl-1,1-dioxothiolane-3-carbohydrazide |
|---|---|
| PubChem CID | 8843879 |
| Molecular Formula | C13H18N2O5S2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | (3S)-N'-(2,4-dimethylphenyl)sulfonyl-1,1-dioxothiolane-3-carbohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)[C@@H]2CCS(=O)(=O)C2)c(C)c1 |
| InChI | InChI=1S/C13H18N2O5S2/c1-9-3-4-12(10(2)7-9)22(19,20)15-14-13(16)11-5-6-21(17,18)8-11/h3-4,7,11,15H,5-6,8H2,1-2H3,(H,14,16)/t11-/m1/s1 |
| InChIKey | HWOOWKREYMOTAG-LLVKDONJSA-N |
| XLogP | 0.05 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|