C12H13F3N2O5S2 — CID 8843976
(3R)-1,1-dioxo-N'-[4-(trifluoromethyl)phenyl]sulfonylthiolane-3-carbohydrazide (PubChem CID 8843976) has the molecular formula C12H13F3N2O5S2 and a molecular weight of 386.37 g/mol. Its IUPAC name is (3R)-1,1-dioxo-N'-[4-(trifluoromethyl)phenyl]sulfonylthiolane-3-carbohydrazide.
| Compound Name | (3R)-1,1-dioxo-N'-[4-(trifluoromethyl)phenyl]sulfonylthiolane-3-carbohydrazide |
|---|---|
| PubChem CID | 8843976 |
| Molecular Formula | C12H13F3N2O5S2 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | (3R)-1,1-dioxo-N'-[4-(trifluoromethyl)phenyl]sulfonylthiolane-3-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc(C(F)(F)F)cc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H13F3N2O5S2/c13-12(14,15)9-1-3-10(4-2-9)24(21,22)17-16-11(18)8-5-6-23(19,20)7-8/h1-4,8,17H,5-7H2,(H,16,18)/t8-/m0/s1 |
| InChIKey | VRXQQQKGEPAZCZ-QMMMGPOBSA-N |
| XLogP | 0.45 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|