C12H16N2O5S2 — CID 55428677
N'-(3-methylphenyl)sulfonyl-1,1-dioxothiolane-3-carbohydrazide (PubChem CID 55428677) has the molecular formula C12H16N2O5S2 and a molecular weight of 332.40 g/mol. Its IUPAC name is N'-(3-methylphenyl)sulfonyl-1,1-dioxothiolane-3-carbohydrazide.
| Compound Name | N'-(3-methylphenyl)sulfonyl-1,1-dioxothiolane-3-carbohydrazide |
|---|---|
| PubChem CID | 55428677 |
| Molecular Formula | C12H16N2O5S2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N'-(3-methylphenyl)sulfonyl-1,1-dioxothiolane-3-carbohydrazide |
| SMILES | Cc1cccc(S(=O)(=O)NNC(=O)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C12H16N2O5S2/c1-9-3-2-4-11(7-9)21(18,19)14-13-12(15)10-5-6-20(16,17)8-10/h2-4,7,10,14H,5-6,8H2,1H3,(H,13,15) |
| InChIKey | DJCUYSIMAUKINA-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|