C15H22N2O5S2 — CID 99940159
(3R)-N-[3-[(4-methylphenyl)sulfonylamino]propyl]-1,1-dioxothiolane-3-carboxamide (PubChem CID 99940159) has the molecular formula C15H22N2O5S2 and a molecular weight of 374.48 g/mol. Its IUPAC name is (3R)-N-[3-[(4-methylphenyl)sulfonylamino]propyl]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | (3R)-N-[3-[(4-methylphenyl)sulfonylamino]propyl]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 99940159 |
| Molecular Formula | C15H22N2O5S2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (3R)-N-[3-[(4-methylphenyl)sulfonylamino]propyl]-1,1-dioxothiolane-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCNC(=O)[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C15H22N2O5S2/c1-12-3-5-14(6-4-12)24(21,22)17-9-2-8-16-15(18)13-7-10-23(19,20)11-13/h3-6,13,17H,2,7-11H2,1H3,(H,16,18)/t13-/m0/s1 |
| InChIKey | YUCZMBVVZJFGFD-ZDUSSCGKSA-N |
| XLogP | 0.21 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|