C16H22N2O3S — CID 134039501
N-[2-[(4-methylphenyl)sulfonylamino]ethyl]cyclohex-3-ene-1-carboxamide (PubChem CID 134039501) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is N-[2-[(4-methylphenyl)sulfonylamino]ethyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[2-[(4-methylphenyl)sulfonylamino]ethyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 134039501 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-[2-[(4-methylphenyl)sulfonylamino]ethyl]cyclohex-3-ene-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)C2CC=CCC2)cc1 |
| InChI | InChI=1S/C16H22N2O3S/c1-13-7-9-15(10-8-13)22(20,21)18-12-11-17-16(19)14-5-3-2-4-6-14/h2-3,7-10,14,18H,4-6,11-12H2,1H3,(H,17,19) |
| InChIKey | HZXIYZZBDUUGPY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|