C18H28N4O4S — CID 55761983
1-N,1-N-dimethyl-4-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-1,4-dicarboxamide (PubChem CID 55761983) has the molecular formula C18H28N4O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is 1-N,1-N-dimethyl-4-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N,1-N-dimethyl-4-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 55761983 |
| Molecular Formula | C18H28N4O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-N,1-N-dimethyl-4-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-1,4-dicarboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)C2CCN(C(=O)N(C)C)CC2)cc1 |
| InChI | InChI=1S/C18H28N4O4S/c1-14-4-6-16(7-5-14)27(25,26)20-11-10-19-17(23)15-8-12-22(13-9-15)18(24)21(2)3/h4-7,15,20H,8-13H2,1-3H3,(H,19,23) |
| InChIKey | QTYBXBQRWRKDDL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|