C9H14N2O3S — CID 64904761
N-(3-cyanopropyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 64904761) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is N-(3-cyanopropyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(3-cyanopropyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 64904761 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | N-(3-cyanopropyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | N#CCCCNC(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H14N2O3S/c10-4-1-2-5-11-9(12)8-3-6-15(13,14)7-8/h8H,1-3,5-7H2,(H,11,12) |
| InChIKey | RHBVJIPVBHIHAN-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|