C17H17N3O5S2 — CID 9142029
N-[4-[[[(3S)-1,1-dioxothiolane-3-carbonyl]amino]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 9142029) has the molecular formula C17H17N3O5S2 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[4-[[[(3S)-1,1-dioxothiolane-3-carbonyl]amino]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[[[(3S)-1,1-dioxothiolane-3-carbonyl]amino]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9142029 |
| Molecular Formula | C17H17N3O5S2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | N-[4-[[[(3S)-1,1-dioxothiolane-3-carbonyl]amino]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(NNC(=O)[C@@H]1CCS(=O)(=O)C1)c1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C17H17N3O5S2/c21-15(19-20-16(22)12-7-9-27(24,25)10-12)11-3-5-13(6-4-11)18-17(23)14-2-1-8-26-14/h1-6,8,12H,7,9-10H2,(H,18,23)(H,19,21)(H,20,22)/t12-/m1/s1 |
| InChIKey | RFADQEYZSVNVEK-GFCCVEGCSA-N |
| XLogP | 1.20 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|