C16H14N2O4S3 — CID 56809273
N'-(1,1-dioxothiolane-3-carbonyl)thieno[3,2-b][1]benzothiole-2-carbohydrazide (PubChem CID 56809273) has the molecular formula C16H14N2O4S3 and a molecular weight of 394.50 g/mol. Its IUPAC name is N'-(1,1-dioxothiolane-3-carbonyl)thieno[3,2-b][1]benzothiole-2-carbohydrazide.
| Compound Name | N'-(1,1-dioxothiolane-3-carbonyl)thieno[3,2-b][1]benzothiole-2-carbohydrazide |
|---|---|
| PubChem CID | 56809273 |
| Molecular Formula | C16H14N2O4S3 |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | N'-(1,1-dioxothiolane-3-carbonyl)thieno[3,2-b][1]benzothiole-2-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCS(=O)(=O)C1)c1cc2sc3ccccc3c2s1 |
| InChI | InChI=1S/C16H14N2O4S3/c19-15(9-5-6-25(21,22)8-9)17-18-16(20)13-7-12-14(24-13)10-3-1-2-4-11(10)23-12/h1-4,7,9H,5-6,8H2,(H,17,19)(H,18,20) |
| InChIKey | PUUCLJJPPGHHFN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|