C16H17N3O4S2 — CID 9142196
N'-[(3S)-1,1-dioxothiolane-3-carbonyl]-2-methyl-4-phenyl-1,3-thiazole-5-carbohydrazide (PubChem CID 9142196) has the molecular formula C16H17N3O4S2 and a molecular weight of 379.46 g/mol. Its IUPAC name is N'-[(3S)-1,1-dioxothiolane-3-carbonyl]-2-methyl-4-phenyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[(3S)-1,1-dioxothiolane-3-carbonyl]-2-methyl-4-phenyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 9142196 |
| Molecular Formula | C16H17N3O4S2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | N'-[(3S)-1,1-dioxothiolane-3-carbonyl]-2-methyl-4-phenyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccccc2)c(C(=O)NNC(=O)[C@@H]2CCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C16H17N3O4S2/c1-10-17-13(11-5-3-2-4-6-11)14(24-10)16(21)19-18-15(20)12-7-8-25(22,23)9-12/h2-6,12H,7-9H2,1H3,(H,18,20)(H,19,21)/t12-/m1/s1 |
| InChIKey | MVCAFODYZPFKNV-GFCCVEGCSA-N |
| XLogP | 1.31 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|