C17H19N3O4S2 — CID 8940181
N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-2-methyl-4-phenyl-1,3-thiazole-5-carbohydrazide (PubChem CID 8940181) has the molecular formula C17H19N3O4S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-2-methyl-4-phenyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-2-methyl-4-phenyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 8940181 |
| Molecular Formula | C17H19N3O4S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-2-methyl-4-phenyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccccc2)c(C(=O)NNC(=O)C[C@H]2CCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C17H19N3O4S2/c1-11-18-15(13-5-3-2-4-6-13)16(25-11)17(22)20-19-14(21)9-12-7-8-26(23,24)10-12/h2-6,12H,7-10H2,1H3,(H,19,21)(H,20,22)/t12-/m1/s1 |
| InChIKey | AWMBBKRVLSUDJN-GFCCVEGCSA-N |
| XLogP | 1.70 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|