C14H17FN2O4S — CID 8940091
N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-fluoro-4-methylbenzohydrazide (PubChem CID 8940091) has the molecular formula C14H17FN2O4S and a molecular weight of 328.37 g/mol. Its IUPAC name is N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-fluoro-4-methylbenzohydrazide.
| Compound Name | N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-fluoro-4-methylbenzohydrazide |
|---|---|
| PubChem CID | 8940091 |
| Molecular Formula | C14H17FN2O4S |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-fluoro-4-methylbenzohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)C[C@H]2CCS(=O)(=O)C2)cc1F |
| InChI | InChI=1S/C14H17FN2O4S/c1-9-2-3-11(7-12(9)15)14(19)17-16-13(18)6-10-4-5-22(20,21)8-10/h2-3,7,10H,4-6,8H2,1H3,(H,16,18)(H,17,19)/t10-/m1/s1 |
| InChIKey | YTWOFIYDECTXCJ-SNVBAGLBSA-N |
| XLogP | 0.72 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|