C19H20N2O5S — CID 8938684
N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-phenoxybenzohydrazide (PubChem CID 8938684) has the molecular formula C19H20N2O5S and a molecular weight of 388.44 g/mol. Its IUPAC name is N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-phenoxybenzohydrazide.
| Compound Name | N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-phenoxybenzohydrazide |
|---|---|
| PubChem CID | 8938684 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-phenoxybenzohydrazide |
| SMILES | O=C(C[C@H]1CCS(=O)(=O)C1)NNC(=O)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C19H20N2O5S/c22-18(11-14-9-10-27(24,25)13-14)20-21-19(23)15-5-4-8-17(12-15)26-16-6-2-1-3-7-16/h1-8,12,14H,9-11,13H2,(H,20,22)(H,21,23)/t14-/m1/s1 |
| InChIKey | ICHJZYWDEGPWKW-CQSZACIVSA-N |
| XLogP | 2.06 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|