C18H23N3O6S — CID 43070329
N-[3-[[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]carbamoyl]phenyl]oxolane-2-carboxamide (PubChem CID 43070329) has the molecular formula C18H23N3O6S and a molecular weight of 409.46 g/mol. Its IUPAC name is N-[3-[[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]carbamoyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]carbamoyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 43070329 |
| Molecular Formula | C18H23N3O6S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-[3-[[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]carbamoyl]phenyl]oxolane-2-carboxamide |
| SMILES | O=C(CC1CCS(=O)(=O)C1)NNC(=O)c1cccc(NC(=O)C2CCCO2)c1 |
| InChI | InChI=1S/C18H23N3O6S/c22-16(9-12-6-8-28(25,26)11-12)20-21-17(23)13-3-1-4-14(10-13)19-18(24)15-5-2-7-27-15/h1,3-4,10,12,15H,2,5-9,11H2,(H,19,24)(H,20,22)(H,21,23) |
| InChIKey | KSGDXXJADJMPKO-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|