C20H20ClN3O4S — CID 25470546
(2R)-N-[3-[[[2-(4-chlorophenyl)sulfanylacetyl]amino]carbamoyl]phenyl]oxolane-2-carboxamide (PubChem CID 25470546) has the molecular formula C20H20ClN3O4S and a molecular weight of 433.92 g/mol. Its IUPAC name is (2R)-N-[3-[[[2-(4-chlorophenyl)sulfanylacetyl]amino]carbamoyl]phenyl]oxolane-2-carboxamide.
| Compound Name | (2R)-N-[3-[[[2-(4-chlorophenyl)sulfanylacetyl]amino]carbamoyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 25470546 |
| Molecular Formula | C20H20ClN3O4S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | (2R)-N-[3-[[[2-(4-chlorophenyl)sulfanylacetyl]amino]carbamoyl]phenyl]oxolane-2-carboxamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)NNC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C20H20ClN3O4S/c21-14-6-8-16(9-7-14)29-12-18(25)23-24-19(26)13-3-1-4-15(11-13)22-20(27)17-5-2-10-28-17/h1,3-4,6-9,11,17H,2,5,10,12H2,(H,22,27)(H,23,25)(H,24,26)/t17-/m1/s1 |
| InChIKey | JMOBGXLIDNSUOV-QGZVFWFLSA-N |
| XLogP | 3.01 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|