C21H22N2O5S — CID 8939941
(E)-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-(3-phenoxyphenyl)prop-2-enehydrazide (PubChem CID 8939941) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is (E)-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-(3-phenoxyphenyl)prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-(3-phenoxyphenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 8939941 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | (E)-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-(3-phenoxyphenyl)prop-2-enehydrazide |
| SMILES | O=C(/C=C/c1cccc(Oc2ccccc2)c1)NNC(=O)C[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H22N2O5S/c24-20(22-23-21(25)14-17-11-12-29(26,27)15-17)10-9-16-5-4-8-19(13-16)28-18-6-2-1-3-7-18/h1-10,13,17H,11-12,14-15H2,(H,22,24)(H,23,25)/b10-9+/t17-/m1/s1 |
| InChIKey | CFPNPZOPLVPNSK-OAGJVSPASA-N |
| XLogP | 2.46 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|