C19H19FN2O5S — CID 8940077
(E)-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enehydrazide (PubChem CID 8940077) has the molecular formula C19H19FN2O5S and a molecular weight of 406.44 g/mol. Its IUPAC name is (E)-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 8940077 |
| Molecular Formula | C19H19FN2O5S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | (E)-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enehydrazide |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2F)o1)NNC(=O)C[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H19FN2O5S/c20-16-4-2-1-3-15(16)17-7-5-14(27-17)6-8-18(23)21-22-19(24)11-13-9-10-28(25,26)12-13/h1-8,13H,9-12H2,(H,21,23)(H,22,24)/b8-6+/t13-/m1/s1 |
| InChIKey | OOPOLLNJPJAJAD-STMXVASLSA-N |
| XLogP | 2.07 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|