C19H21FN2O5S — CID 55429660
N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-3-[5-(2-fluorophenyl)furan-2-yl]propanehydrazide (PubChem CID 55429660) has the molecular formula C19H21FN2O5S and a molecular weight of 408.45 g/mol. Its IUPAC name is N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-3-[5-(2-fluorophenyl)furan-2-yl]propanehydrazide.
| Compound Name | N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-3-[5-(2-fluorophenyl)furan-2-yl]propanehydrazide |
|---|---|
| PubChem CID | 55429660 |
| Molecular Formula | C19H21FN2O5S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-3-[5-(2-fluorophenyl)furan-2-yl]propanehydrazide |
| SMILES | O=C(CCc1ccc(-c2ccccc2F)o1)NNC(=O)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H21FN2O5S/c20-16-4-2-1-3-15(16)17-7-5-14(27-17)6-8-18(23)21-22-19(24)11-13-9-10-28(25,26)12-13/h1-5,7,13H,6,8-12H2,(H,21,23)(H,22,24) |
| InChIKey | WPJMUPSQVAJSDO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|