C17H17FN2O5S — CID 8940082
N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-5-(2-fluorophenyl)furan-2-carbohydrazide (PubChem CID 8940082) has the molecular formula C17H17FN2O5S and a molecular weight of 380.40 g/mol. Its IUPAC name is N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-5-(2-fluorophenyl)furan-2-carbohydrazide.
| Compound Name | N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-5-(2-fluorophenyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 8940082 |
| Molecular Formula | C17H17FN2O5S |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-5-(2-fluorophenyl)furan-2-carbohydrazide |
| SMILES | O=C(C[C@@H]1CCS(=O)(=O)C1)NNC(=O)c1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C17H17FN2O5S/c18-13-4-2-1-3-12(13)14-5-6-15(25-14)17(22)20-19-16(21)9-11-7-8-26(23,24)10-11/h1-6,11H,7-10H2,(H,19,21)(H,20,22)/t11-/m0/s1 |
| InChIKey | AZYXYZSRUURYCQ-NSHDSACASA-N |
| XLogP | 1.67 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|