C22H21N3O6S — CID 36750167
4-[(1,3-dioxoisoindol-2-yl)methyl]-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide (PubChem CID 36750167) has the molecular formula C22H21N3O6S and a molecular weight of 455.49 g/mol. Its IUPAC name is 4-[(1,3-dioxoisoindol-2-yl)methyl]-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide.
| Compound Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 36750167 |
| Molecular Formula | C22H21N3O6S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide |
| SMILES | O=C(C[C@@H]1CCS(=O)(=O)C1)NNC(=O)c1ccc(CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H21N3O6S/c26-19(11-15-9-10-32(30,31)13-15)23-24-20(27)16-7-5-14(6-8-16)12-25-21(28)17-3-1-2-4-18(17)22(25)29/h1-8,15H,9-13H2,(H,23,26)(H,24,27)/t15-/m0/s1 |
| InChIKey | PTOGVFYPRYXDCO-HNNXBMFYSA-N |
| XLogP | 1.07 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|