C20H26N4O4S — CID 8939553
N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazole-4-carbohydrazide (PubChem CID 8939553) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazole-4-carbohydrazide.
| Compound Name | N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 8939553 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazole-4-carbohydrazide |
| SMILES | Cc1ccc(Cn2nc(C)c(C(=O)NNC(=O)C[C@@H]3CCS(=O)(=O)C3)c2C)cc1 |
| InChI | InChI=1S/C20H26N4O4S/c1-13-4-6-16(7-5-13)11-24-15(3)19(14(2)23-24)20(26)22-21-18(25)10-17-8-9-29(27,28)12-17/h4-7,17H,8-12H2,1-3H3,(H,21,25)(H,22,26)/t17-/m0/s1 |
| InChIKey | TUXMKVLZIWNXER-KRWDZBQOSA-N |
| XLogP | 1.44 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|