C19H23ClN4O3S — CID 8868683
N-[(Z)-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]methylideneamino]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 8868683) has the molecular formula C19H23ClN4O3S and a molecular weight of 422.94 g/mol. Its IUPAC name is N-[(Z)-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]methylideneamino]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | N-[(Z)-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]methylideneamino]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 8868683 |
| Molecular Formula | C19H23ClN4O3S |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N-[(Z)-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]methylideneamino]-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | Cc1ccc(Cn2nc(C)c(/C=N\NC(=O)C[C@H]3CCS(=O)(=O)C3)c2Cl)cc1 |
| InChI | InChI=1S/C19H23ClN4O3S/c1-13-3-5-15(6-4-13)11-24-19(20)17(14(2)23-24)10-21-22-18(25)9-16-7-8-28(26,27)12-16/h3-6,10,16H,7-9,11-12H2,1-2H3,(H,22,25)/b21-10-/t16-/m1/s1 |
| InChIKey | JRRUWDCQWFBHDN-LIQPLZLLSA-N |
| XLogP | 2.48 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|