C15H18ClN5S — CID 9071564
1-[(Z)-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]methylideneamino]-3-methylthiourea (PubChem CID 9071564) has the molecular formula C15H18ClN5S and a molecular weight of 335.86 g/mol. Its IUPAC name is 1-[(Z)-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]methylideneamino]-3-methylthiourea.
| Compound Name | 1-[(Z)-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]methylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 9071564 |
| Molecular Formula | C15H18ClN5S |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 1-[(Z)-[5-chloro-3-methyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]methylideneamino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C\c1c(C)nn(Cc2ccc(C)cc2)c1Cl |
| InChI | InChI=1S/C15H18ClN5S/c1-10-4-6-12(7-5-10)9-21-14(16)13(11(2)20-21)8-18-19-15(22)17-3/h4-8H,9H2,1-3H3,(H2,17,19,22)/b18-8- |
| InChIKey | NBFSDQBHUNAMPJ-LSCVHKIXSA-N |
| XLogP | 2.63 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|