C19H24N4O4S — CID 9083217
N'-[(3S)-1,1-dioxothiolane-3-carbonyl]-3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazole-4-carbohydrazide (PubChem CID 9083217) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is N'-[(3S)-1,1-dioxothiolane-3-carbonyl]-3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazole-4-carbohydrazide.
| Compound Name | N'-[(3S)-1,1-dioxothiolane-3-carbonyl]-3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9083217 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N'-[(3S)-1,1-dioxothiolane-3-carbonyl]-3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazole-4-carbohydrazide |
| SMILES | Cc1ccc(Cn2nc(C)c(C(=O)NNC(=O)[C@@H]3CCS(=O)(=O)C3)c2C)cc1 |
| InChI | InChI=1S/C19H24N4O4S/c1-12-4-6-15(7-5-12)10-23-14(3)17(13(2)22-23)19(25)21-20-18(24)16-8-9-28(26,27)11-16/h4-7,16H,8-11H2,1-3H3,(H,20,24)(H,21,25)/t16-/m1/s1 |
| InChIKey | ZEBJWLDUASKZHN-MRXNPFEDSA-N |
| XLogP | 1.05 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|