C18H21N3O4S — CID 55650196
N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-2,7-dimethylquinoline-3-carbohydrazide (PubChem CID 55650196) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-2,7-dimethylquinoline-3-carbohydrazide.
| Compound Name | N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-2,7-dimethylquinoline-3-carbohydrazide |
|---|---|
| PubChem CID | 55650196 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N'-[2-(1,1-dioxothiolan-3-yl)acetyl]-2,7-dimethylquinoline-3-carbohydrazide |
| SMILES | Cc1ccc2cc(C(=O)NNC(=O)CC3CCS(=O)(=O)C3)c(C)nc2c1 |
| InChI | InChI=1S/C18H21N3O4S/c1-11-3-4-14-9-15(12(2)19-16(14)7-11)18(23)21-20-17(22)8-13-5-6-26(24,25)10-13/h3-4,7,9,13H,5-6,8,10H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | PMCRPRAGALOCNZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|