C22H16FN3O4 — CID 9140747
(E)-N'-[2-(4-cyanophenoxy)acetyl]-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enehydrazide (PubChem CID 9140747) has the molecular formula C22H16FN3O4 and a molecular weight of 405.39 g/mol. Its IUPAC name is (E)-N'-[2-(4-cyanophenoxy)acetyl]-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enehydrazide.
| Compound Name | (E)-N'-[2-(4-cyanophenoxy)acetyl]-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 9140747 |
| Molecular Formula | C22H16FN3O4 |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | (E)-N'-[2-(4-cyanophenoxy)acetyl]-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enehydrazide |
| SMILES | N#Cc1ccc(OCC(=O)NNC(=O)/C=C/c2ccc(-c3ccccc3F)o2)cc1 |
| InChI | InChI=1S/C22H16FN3O4/c23-19-4-2-1-3-18(19)20-11-9-17(30-20)10-12-21(27)25-26-22(28)14-29-16-7-5-15(13-24)6-8-16/h1-12H,14H2,(H,25,27)(H,26,28)/b12-10+ |
| InChIKey | MJWYURYWGNUXAU-ZRDIBKRKSA-N |
| XLogP | 3.20 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|