C21H18N4O5 — CID 2372181
N'-[2-(4-cyanophenoxy)acetyl]-4-(1,3-dioxoisoindol-2-yl)butanehydrazide (PubChem CID 2372181) has the molecular formula C21H18N4O5 and a molecular weight of 406.40 g/mol. Its IUPAC name is N'-[2-(4-cyanophenoxy)acetyl]-4-(1,3-dioxoisoindol-2-yl)butanehydrazide.
| Compound Name | N'-[2-(4-cyanophenoxy)acetyl]-4-(1,3-dioxoisoindol-2-yl)butanehydrazide |
|---|---|
| PubChem CID | 2372181 |
| Molecular Formula | C21H18N4O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N'-[2-(4-cyanophenoxy)acetyl]-4-(1,3-dioxoisoindol-2-yl)butanehydrazide |
| SMILES | N#Cc1ccc(OCC(=O)NNC(=O)CCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H18N4O5/c22-12-14-7-9-15(10-8-14)30-13-19(27)24-23-18(26)6-3-11-25-20(28)16-4-1-2-5-17(16)21(25)29/h1-2,4-5,7-10H,3,6,11,13H2,(H,23,26)(H,24,27) |
| InChIKey | HUBBQMVEWNFRGY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|