C26H26N4O5 — CID 26002981
3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N'-[2-[4-(4-cyanophenyl)phenoxy]acetyl]propanehydrazide (PubChem CID 26002981) has the molecular formula C26H26N4O5 and a molecular weight of 474.52 g/mol. Its IUPAC name is 3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N'-[2-[4-(4-cyanophenyl)phenoxy]acetyl]propanehydrazide.
| Compound Name | 3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N'-[2-[4-(4-cyanophenyl)phenoxy]acetyl]propanehydrazide |
|---|---|
| PubChem CID | 26002981 |
| Molecular Formula | C26H26N4O5 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N'-[2-[4-(4-cyanophenyl)phenoxy]acetyl]propanehydrazide |
| SMILES | N#Cc1ccc(-c2ccc(OCC(=O)NNC(=O)CCN3C(=O)[C@H]4CCCC[C@H]4C3=O)cc2)cc1 |
| InChI | InChI=1S/C26H26N4O5/c27-15-17-5-7-18(8-6-17)19-9-11-20(12-10-19)35-16-24(32)29-28-23(31)13-14-30-25(33)21-3-1-2-4-22(21)26(30)34/h5-12,21-22H,1-4,13-14,16H2,(H,28,31)(H,29,32)/t21-,22+ |
| InChIKey | KDOYBTWYOYKXSJ-SZPZYZBQSA-N |
| XLogP | 2.32 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|