C19H21F3N2O4 — CID 134010367
3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[4-(2,2,2-trifluoroethoxy)phenyl]propanamide (PubChem CID 134010367) has the molecular formula C19H21F3N2O4 and a molecular weight of 398.38 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[4-(2,2,2-trifluoroethoxy)phenyl]propanamide.
| Compound Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[4-(2,2,2-trifluoroethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 134010367 |
| Molecular Formula | C19H21F3N2O4 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[4-(2,2,2-trifluoroethoxy)phenyl]propanamide |
| SMILES | O=C(CCN1C(=O)C2CCCCC2C1=O)Nc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H21F3N2O4/c20-19(21,22)11-28-13-7-5-12(6-8-13)23-16(25)9-10-24-17(26)14-3-1-2-4-15(14)18(24)27/h5-8,14-15H,1-4,9-11H2,(H,23,25) |
| InChIKey | IZQHZXMWMRIGNG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|