C18H19N3O3 — CID 134035362
N-[(4-cyanophenyl)methyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide (PubChem CID 134035362) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 134035362 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide |
| SMILES | N#Cc1ccc(CNC(=O)CN2C(=O)C3CCCCC3C2=O)cc1 |
| InChI | InChI=1S/C18H19N3O3/c19-9-12-5-7-13(8-6-12)10-20-16(22)11-21-17(23)14-3-1-2-4-15(14)18(21)24/h5-8,14-15H,1-4,10-11H2,(H,20,22) |
| InChIKey | WMJLFIXIDFHRDD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|