C23H24N2O4 — CID 51656467
2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(3-phenoxyphenyl)methyl]acetamide (PubChem CID 51656467) has the molecular formula C23H24N2O4 and a molecular weight of 392.45 g/mol. Its IUPAC name is 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(3-phenoxyphenyl)methyl]acetamide.
| Compound Name | 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(3-phenoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 51656467 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(3-phenoxyphenyl)methyl]acetamide |
| SMILES | O=C(CN1C(=O)[C@H]2CCCC[C@@H]2C1=O)NCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C23H24N2O4/c26-21(15-25-22(27)19-11-4-5-12-20(19)23(25)28)24-14-16-7-6-10-18(13-16)29-17-8-2-1-3-9-17/h1-3,6-10,13,19-20H,4-5,11-12,14-15H2,(H,24,26)/t19-,20-/m0/s1 |
| InChIKey | LQODTCZMQZXZRY-PMACEKPBSA-N |
| XLogP | 3.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|