C22H23N3O4 — CID 39576210
2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(3-phenoxyphenyl)methyl]acetamide (PubChem CID 39576210) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(3-phenoxyphenyl)methyl]acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(3-phenoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 39576210 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[(3-phenoxyphenyl)methyl]acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCC2)C1=O)NCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C22H23N3O4/c26-19(15-25-20(27)22(24-21(25)28)11-4-5-12-22)23-14-16-7-6-10-18(13-16)29-17-8-2-1-3-9-17/h1-3,6-10,13H,4-5,11-12,14-15H2,(H,23,26)(H,24,28) |
| InChIKey | AHAZJKCMQUPCQH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|