C24H26N2O4 — CID 51113723
3-[2-oxo-2-(4-phenoxyphenyl)ethyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione (PubChem CID 51113723) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 3-[2-oxo-2-(4-phenoxyphenyl)ethyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione.
| Compound Name | 3-[2-oxo-2-(4-phenoxyphenyl)ethyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione |
|---|---|
| PubChem CID | 51113723 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 3-[2-oxo-2-(4-phenoxyphenyl)ethyl]-1,3-diazaspiro[4.7]dodecane-2,4-dione |
| SMILES | O=C(CN1C(=O)NC2(CCCCCCC2)C1=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C24H26N2O4/c27-21(18-11-13-20(14-12-18)30-19-9-5-4-6-10-19)17-26-22(28)24(25-23(26)29)15-7-2-1-3-8-16-24/h4-6,9-14H,1-3,7-8,15-17H2,(H,25,29) |
| InChIKey | OYIRKRKKWDHVBJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|