C22H18F2N4O4 — CID 118366430
6-[4-[2-(8,8-difluoro-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]phenoxy]pyridine-2-carbonitrile (PubChem CID 118366430) has the molecular formula C22H18F2N4O4 and a molecular weight of 440.41 g/mol. Its IUPAC name is 6-[4-[2-(8,8-difluoro-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]phenoxy]pyridine-2-carbonitrile.
| Compound Name | 6-[4-[2-(8,8-difluoro-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]phenoxy]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 118366430 |
| Molecular Formula | C22H18F2N4O4 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 6-[4-[2-(8,8-difluoro-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]phenoxy]pyridine-2-carbonitrile |
| SMILES | N#Cc1cccc(Oc2ccc(C(=O)CN3C(=O)NC4(CCC(F)(F)CC4)C3=O)cc2)n1 |
| InChI | InChI=1S/C22H18F2N4O4/c23-22(24)10-8-21(9-11-22)19(30)28(20(31)27-21)13-17(29)14-4-6-16(7-5-14)32-18-3-1-2-15(12-25)26-18/h1-7H,8-11,13H2,(H,27,31) |
| InChIKey | NFLDKFUQPHGJDF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|