C24H24F2N4O4 — CID 118366455
N-[[3-[4-[2-(8,8-difluoro-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]phenyl]-2-pyridinyl]methyl]acetamide (PubChem CID 118366455) has the molecular formula C24H24F2N4O4 and a molecular weight of 470.48 g/mol. Its IUPAC name is N-[[3-[4-[2-(8,8-difluoro-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]phenyl]-2-pyridinyl]methyl]acetamide.
| Compound Name | N-[[3-[4-[2-(8,8-difluoro-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]phenyl]-2-pyridinyl]methyl]acetamide |
|---|---|
| PubChem CID | 118366455 |
| Molecular Formula | C24H24F2N4O4 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | N-[[3-[4-[2-(8,8-difluoro-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]phenyl]-2-pyridinyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ncccc1-c1ccc(C(=O)CN2C(=O)NC3(CCC(F)(F)CC3)C2=O)cc1 |
| InChI | InChI=1S/C24H24F2N4O4/c1-15(31)28-13-19-18(3-2-12-27-19)16-4-6-17(7-5-16)20(32)14-30-21(33)23(29-22(30)34)8-10-24(25,26)11-9-23/h2-7,12H,8-11,13-14H2,1H3,(H,28,31)(H,29,34) |
| InChIKey | MENWCIZVXAFACY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|