C22H21F2N3O4 — CID 118366358
8,8-difluoro-3-[2-[4-[3-(hydroxymethyl)-2-pyridinyl]phenyl]-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 118366358) has the molecular formula C22H21F2N3O4 and a molecular weight of 429.42 g/mol. Its IUPAC name is 8,8-difluoro-3-[2-[4-[3-(hydroxymethyl)-2-pyridinyl]phenyl]-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8,8-difluoro-3-[2-[4-[3-(hydroxymethyl)-2-pyridinyl]phenyl]-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 118366358 |
| Molecular Formula | C22H21F2N3O4 |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 8,8-difluoro-3-[2-[4-[3-(hydroxymethyl)-2-pyridinyl]phenyl]-2-oxoethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C(CN1C(=O)NC2(CCC(F)(F)CC2)C1=O)c1ccc(-c2ncccc2CO)cc1 |
| InChI | InChI=1S/C22H21F2N3O4/c23-22(24)9-7-21(8-10-22)19(30)27(20(31)26-21)12-17(29)14-3-5-15(6-4-14)18-16(13-28)2-1-11-25-18/h1-6,11,28H,7-10,12-13H2,(H,26,31) |
| InChIKey | RFLKLYRRGKXEDS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|