C21H26FN3O4 — CID 46483879
N-[2-[4-[2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetyl]-2-fluorophenyl]ethyl]acetamide (PubChem CID 46483879) has the molecular formula C21H26FN3O4 and a molecular weight of 403.45 g/mol. Its IUPAC name is N-[2-[4-[2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetyl]-2-fluorophenyl]ethyl]acetamide.
| Compound Name | N-[2-[4-[2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetyl]-2-fluorophenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 46483879 |
| Molecular Formula | C21H26FN3O4 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[2-[4-[2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetyl]-2-fluorophenyl]ethyl]acetamide |
| SMILES | CC(=O)NCCc1ccc(C(=O)CN2C(=O)NC3(CCCCCC3)C2=O)cc1F |
| InChI | InChI=1S/C21H26FN3O4/c1-14(26)23-11-8-15-6-7-16(12-17(15)22)18(27)13-25-19(28)21(24-20(25)29)9-4-2-3-5-10-21/h6-7,12H,2-5,8-11,13H2,1H3,(H,23,26)(H,24,29) |
| InChIKey | HOVUCXDUEMASFL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|