C17H18FN3O4 — CID 9390123
N-[4-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]-3-fluorophenyl]acetamide (PubChem CID 9390123) has the molecular formula C17H18FN3O4 and a molecular weight of 347.35 g/mol. Its IUPAC name is N-[4-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]-3-fluorophenyl]acetamide.
| Compound Name | N-[4-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]-3-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 9390123 |
| Molecular Formula | C17H18FN3O4 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[4-[2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetyl]-3-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(=O)CN2C(=O)NC3(CCCC3)C2=O)c(F)c1 |
| InChI | InChI=1S/C17H18FN3O4/c1-10(22)19-11-4-5-12(13(18)8-11)14(23)9-21-15(24)17(20-16(21)25)6-2-3-7-17/h4-5,8H,2-3,6-7,9H2,1H3,(H,19,22)(H,20,25) |
| InChIKey | CKHUNDLFVIYMFU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|