C19H22F2N4O4 — CID 9401939
N-(3,4-difluorophenyl)-2-[[2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetyl]amino]acetamide (PubChem CID 9401939) has the molecular formula C19H22F2N4O4 and a molecular weight of 408.41 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-[[2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetyl]amino]acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-[[2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 9401939 |
| Molecular Formula | C19H22F2N4O4 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-[[2-(2,4-dioxo-1,3-diazaspiro[4.6]undecan-3-yl)acetyl]amino]acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCCCC2)C1=O)NCC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H22F2N4O4/c20-13-6-5-12(9-14(13)21)23-15(26)10-22-16(27)11-25-17(28)19(24-18(25)29)7-3-1-2-4-8-19/h5-6,9H,1-4,7-8,10-11H2,(H,22,27)(H,23,26)(H,24,29) |
| InChIKey | NSWRDOKRGZJEJH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|