C22H22N2O5 — CID 7821352
(2-phenoxyphenyl)methyl 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 7821352) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is (2-phenoxyphenyl)methyl 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | (2-phenoxyphenyl)methyl 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 7821352 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (2-phenoxyphenyl)methyl 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | O=C(CN1C(=O)NC2(CCCC2)C1=O)OCc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C22H22N2O5/c25-19(14-24-20(26)22(23-21(24)27)12-6-7-13-22)28-15-16-8-4-5-11-18(16)29-17-9-2-1-3-10-17/h1-5,8-11H,6-7,12-15H2,(H,23,27) |
| InChIKey | BVWAXCJDMWPSOG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|