C16H17BrN2O4 — CID 9439184
(2-bromophenyl) 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 9439184) has the molecular formula C16H17BrN2O4 and a molecular weight of 381.23 g/mol. Its IUPAC name is (2-bromophenyl) 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | (2-bromophenyl) 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 9439184 |
| Molecular Formula | C16H17BrN2O4 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | (2-bromophenyl) 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | O=C(CN1C(=O)NC2(CCCCC2)C1=O)Oc1ccccc1Br |
| InChI | InChI=1S/C16H17BrN2O4/c17-11-6-2-3-7-12(11)23-13(20)10-19-14(21)16(18-15(19)22)8-4-1-5-9-16/h2-3,6-7H,1,4-5,8-10H2,(H,18,22) |
| InChIKey | ISRKOMLVEULIBR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|